1-hydroxy-2-unsubstituted benzenoids
Medchemexpress LLC 3-(4-Hydroxyphenyl)-1-propanol (Dihydro-p-coumaryl alcohol) | 10210-17-0 | MFCD00002953 | 152.19 | 5 G
3-(4-Hydroxyphenyl)-1-propanol is a metabolite. It can be isolated from *P. radiate* callus cultures and is associated with CAD activity.
- For research use only.
- Not intended for human use.
eMolecules 89466-08-0 | ChemScene | 2-Hydroxyphenylboronic acid | 1g | 596089880 | CS-W002733 | MFCD01074581 | 137.93 | C6H7BO3
ChemScene | 2-Hydroxyphenylboronic acid | 1g | 596089880 | CS-W002733 | 89466-08-0 | MFCD01074581 | 137.930 | C6H7BO3
![Medchemexpress LLC 1,2-Bis(4-(benzo[d]oxazol-2-yl)phenyl)ethene | 1533-45-5 | 414.45 | 100 G](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000451701-logo.png-250.jpg){kind=logo}
Medchemexpress LLC 1,2-Bis(4-(benzo[d]oxazol-2-yl)phenyl)ethene | 1533-45-5 | 414.45 | 100 G
1,2-Bis(4-(benzo[d]oxazol-2-yl)phenyl)ethene is a biochemical reagent that can be used as a biological material or an organic compound for life science related research. It appears as a solid with a light yellow to yellow color. This product is for research use only and not for sale to patients.
- Biochemical reagent
- Biological material or organic compound for life science related research
- Solid with a light yellow to yellow color
Selleck Chemical LLC 4-Bromo-3-hydroxybenzoic acid S5444-25mg
4-bromo-3-hydroxybenzoic acid is a potent inhibitor of the enzyme histidine decarboxylase with resultant inhibition of histamine formation in mammals
eMolecules 621-37-4 | 3-Hydroxyphenylacetic acid | Key Organics/BIONET | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 5mg | 564159605
3-Hydroxyphenylacetic acid | Key Organics/BIONET | 621-37-4 | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 5mg | 564159605
![eMolecules 5339-74-2 | 2-[(4-Hydroxyphenyl)methylene]-hydrazinecarbothioamide | Oakwood Chemical | MFCD00461931 | 195.240 | C8H9N3OS | 0.000 | NC(=S)N\N=C\c1ccc(O)cc1 | 10mg | 537703431](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502148404.JPG-250.jpg)
eMolecules 5339-74-2 | 2-[(4-Hydroxyphenyl)methylene]-hydrazinecarbothioamide | Oakwood Chemical | MFCD00461931 | 195.240 | C8H9N3OS | 0.000 | NC(=S)N\N=C\c1ccc(O)cc1 | 10mg | 537703431
2-[(4-Hydroxyphenyl)methylene]-hydrazinecarbothioamide | Oakwood Chemical | 5339-74-2 | MFCD00461931 | 195.240 | C8H9N3OS | 0.000 | NC(=S)N\N=C\c1ccc(O)cc1 | 10mg | 537703431
Medchemexpress LLC 4-hydroxybenzoic acid-d4 | 152404-47-2 | MFCD01074045 | 100.0% | 142.15 g/mol | C7H2D4O3 | 50mg
4-Hydroxybenzoic acid-d4 is the deuterium labeled 4-Hydroxybenzoic acid 4-Hydroxybenzoic acid a phenolic derivative of benzoic acid could inhibit most gram-positive and some gram-negative bacteria with an IC50 of 160 g/mL
Chemscene ChemScene | 3-Chloro-4-hydroxybenzoic acid | 500G | CS-0063147 | 0.98 | 3964-58-7| MFCD00002549 | 172.57
ChemScene | 3-Chloro-4-hydroxybenzoic acid | 500G | CS-0063147 | 0.98 | 3964-58-7| MFCD00002549 | 172.57
eMolecules 621-37-4 | 3-Hydroxyphenylacetic acid | Key Organics/BIONET | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 50mg | 564159607
3-Hydroxyphenylacetic acid | Key Organics/BIONET | 621-37-4 | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 50mg | 564159607
eMolecules 71597-85-8 | (4-hydroxyphenyl)boronic acid | Pharmablock | MFCD01074628 | 137.930 | C6H7BO3 | 97.000 | OB(O)c1ccc(O)cc1 | 500mg | 594229570
(4-hydroxyphenyl)boronic acid | Pharmablock | 71597-85-8 | MFCD01074628 | 137.930 | C6H7BO3 | 97.000 | OB(O)c1ccc(O)cc1 | 500mg | 594229570
eMolecules 621-37-4 | 3-Hydroxyphenylacetic acid | Oakwood Chemicals | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 100g | 480141261
3-Hydroxyphenylacetic acid | Oakwood Chemicals | 621-37-4 | MFCD00004337 | 152.149 | C8H8O3 | 97.000 | OC(=O)Cc1cccc(O)c1 | 100g | 480141261
eMolecules 89466-08-0 | 2-Hydroxyphenylboronic acid | Oakwood Chemical | MFCD01074581 | 137.930 | C6H7BO3 | 98.000 | OB(O)c1ccccc1O | 5g | 537684492
2-Hydroxyphenylboronic acid | Oakwood Chemical | 89466-08-0 | MFCD01074581 | 137.930 | C6H7BO3 | 98.000 | OB(O)c1ccccc1O | 5g | 537684492
eMolecules 71597-85-8 | 4-Hydroxyphenylboronic Acid | AA Blocks LLC | MFCD01074628 | 137.930 | C6H7BO3 | 0.000 | OB(O)c1ccc(O)cc1 | 5g | 410165603
4-Hydroxyphenylboronic Acid | AA Blocks LLC | 71597-85-8 | MFCD01074628 | 137.930 | C6H7BO3 | 0.000 | OB(O)c1ccc(O)cc1 | 5g | 410165603
Medchemexpress LLC 3-Hydroxybenzoic acid | 99-06-9 | MFCD00002506 | 138.12 | 500 MG
3-Hydroxybenzoic acid is an orally active endogenous metabolite. It acts as an agonist for GPR81 and GPR109A, and functions as a stress response desensitizer. This compound can be utilized for anti-inflammatory and analgesic studies.
- Acts as an agonist for GPR81 and GPR109A
- Functions as a stress response desensitizer
- Used for anti-inflammatory studies
- Used for analgesic studies
- Inhibits cAMP accumulation in SK-N-MC cells
- Inhibits free fatty acid and glycerol release
![eMolecules 1421263-30-0 | 4-(4-Hydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]-thiazole | Oakwood Chemicals | MFCD22683009 | 321.320 | C16H10F3NOS | 97.000 | Oc1ccc(cc1)-c1csc(n1)-c1ccc(cc1)C(F)(F)F | 1g | 480147747](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502142733.JPG-250.jpg)
eMolecules 1421263-30-0 | 4-(4-Hydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]-thiazole | Oakwood Chemicals | MFCD22683009 | 321.320 | C16H10F3NOS | 97.000 | Oc1ccc(cc1)-c1csc(n1)-c1ccc(cc1)C(F)(F)F | 1g | 480147747
4-(4-Hydroxyphenyl)-2-[4-(trifluoromethyl)phenyl]-thiazole | Oakwood Chemicals | 1421263-30-0 | MFCD22683009 | 321.320 | C16H10F3NOS | 97.000 | Oc1ccc(cc1)-c1csc(n1)-c1ccc(cc1)C(F)(F)F | 1g | 480147747